C8H9ClN4O4S2 — CID 57059830
methyl N-[[(2-chloro-1,3-thiazol-5-yl)methyl-nitroamino]-methylsulfanylmethylidene]carbamate (PubChem CID 57059830) has the molecular formula C8H9ClN4O4S2 and a molecular weight of 324.77 g/mol. Its IUPAC name is methyl N-[[(2-chloro-1,3-thiazol-5-yl)methyl-nitroamino]-methylsulfanylmethylidene]carbamate.
| Compound Name | methyl N-[[(2-chloro-1,3-thiazol-5-yl)methyl-nitroamino]-methylsulfanylmethylidene]carbamate |
|---|---|
| PubChem CID | 57059830 |
| Molecular Formula | C8H9ClN4O4S2 |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | methyl N-[[(2-chloro-1,3-thiazol-5-yl)methyl-nitroamino]-methylsulfanylmethylidene]carbamate |
| SMILES | COC(=O)N=C(SC)N(Cc1cnc(Cl)s1)[N+](=O)[O-] |
| InChI | InChI=1S/C8H9ClN4O4S2/c1-17-8(14)11-7(18-2)12(13(15)16)4-5-3-10-6(9)19-5/h3H,4H2,1-2H3 |
| InChIKey | GGEOVLRHBRRGNA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 97.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|