C13H11ClN4O4S2 — CID 70204869
phenyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(C-methylsulfanyl-N-nitrocarbonimidoyl)carbamate (PubChem CID 70204869) has the molecular formula C13H11ClN4O4S2 and a molecular weight of 386.84 g/mol. Its IUPAC name is phenyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(C-methylsulfanyl-N-nitrocarbonimidoyl)carbamate.
| Compound Name | phenyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(C-methylsulfanyl-N-nitrocarbonimidoyl)carbamate |
|---|---|
| PubChem CID | 70204869 |
| Molecular Formula | C13H11ClN4O4S2 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | phenyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(C-methylsulfanyl-N-nitrocarbonimidoyl)carbamate |
| SMILES | CSC(=N[N+](=O)[O-])N(Cc1cnc(Cl)s1)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C13H11ClN4O4S2/c1-23-12(16-18(20)21)17(8-10-7-15-11(14)24-10)13(19)22-9-5-3-2-4-6-9/h2-7H,8H2,1H3 |
| InChIKey | GYFYZMXVYZFQML-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 97.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|