C13H22ClN9O5S — CID 172983341
1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-methyl-2-nitroguanidine;1-methyl-2-nitro-3-(oxolan-3-ylmethyl)guanidine (PubChem CID 172983341) has the molecular formula C13H22ClN9O5S and a molecular weight of 451.90 g/mol. Its IUPAC name is 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-methyl-2-nitroguanidine;1-methyl-2-nitro-3-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-methyl-2-nitroguanidine;1-methyl-2-nitro-3-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 172983341 |
| Molecular Formula | C13H22ClN9O5S |
| Molecular Weight | 451.90 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-methyl-2-nitroguanidine;1-methyl-2-nitro-3-(oxolan-3-ylmethyl)guanidine |
| SMILES | CN/C(=N\[N+](=O)[O-])NCC1CCOC1.CN/C(=N\[N+](=O)[O-])NCc1cnc(Cl)s1 |
| InChI | InChI=1S/C7H14N4O3.C6H8ClN5O2S/c1-8-7(10-11(12)13)9-4-6-2-3-14-5-6;1-8-6(11-12(13)14)10-3-4-2-9-5(7)15-4/h6H,2-5H2,1H3,(H2,8,9,10);2H,3H2,1H3,(H2,8,10,11) |
| InChIKey | VHSIRPHBURJTQF-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 181.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.90 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|