C15H16ClN5O4S2 — CID 139606826
2-(benzenesulfonamido)ethyl N-[(6-chloro-3-pyridinyl)methyl]-N'-nitrocarbamimidothioate (PubChem CID 139606826) has the molecular formula C15H16ClN5O4S2 and a molecular weight of 429.91 g/mol. Its IUPAC name is 2-(benzenesulfonamido)ethyl N-[(6-chloro-3-pyridinyl)methyl]-N'-nitrocarbamimidothioate.
| Compound Name | 2-(benzenesulfonamido)ethyl N-[(6-chloro-3-pyridinyl)methyl]-N'-nitrocarbamimidothioate |
|---|---|
| PubChem CID | 139606826 |
| Molecular Formula | C15H16ClN5O4S2 |
| Molecular Weight | 429.91 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | 2-(benzenesulfonamido)ethyl N-[(6-chloro-3-pyridinyl)methyl]-N'-nitrocarbamimidothioate |
| SMILES | O=[N+]([O-])N=C(NCc1ccc(Cl)nc1)SCCNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H16ClN5O4S2/c16-14-7-6-12(10-17-14)11-18-15(20-21(22)23)26-9-8-19-27(24,25)13-4-2-1-3-5-13/h1-7,10,19H,8-9,11H2,(H,18,20) |
| InChIKey | VQOIQCCKODUHCA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 126.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.91 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|