C22H21Cl2N3O4S — CID 31411571
2-chloro-N-[(6-chloro-3-pyridinyl)methyl]-N-methyl-5-(2-phenoxyethylsulfamoyl)benzamide (PubChem CID 31411571) has the molecular formula C22H21Cl2N3O4S and a molecular weight of 494.40 g/mol. Its IUPAC name is 2-chloro-N-[(6-chloro-3-pyridinyl)methyl]-N-methyl-5-(2-phenoxyethylsulfamoyl)benzamide.
| Compound Name | 2-chloro-N-[(6-chloro-3-pyridinyl)methyl]-N-methyl-5-(2-phenoxyethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 31411571 |
| Molecular Formula | C22H21Cl2N3O4S |
| Molecular Weight | 494.40 g/mol |
| Exact Mass | 493.06 |
| IUPAC Name | 2-chloro-N-[(6-chloro-3-pyridinyl)methyl]-N-methyl-5-(2-phenoxyethylsulfamoyl)benzamide |
| SMILES | CN(Cc1ccc(Cl)nc1)C(=O)c1cc(S(=O)(=O)NCCOc2ccccc2)ccc1Cl |
| InChI | InChI=1S/C22H21Cl2N3O4S/c1-27(15-16-7-10-21(24)25-14-16)22(28)19-13-18(8-9-20(19)23)32(29,30)26-11-12-31-17-5-3-2-4-6-17/h2-10,13-14,26H,11-12,15H2,1H3 |
| InChIKey | FBADQTVLOOSKBN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|