C23H32ClN3O4S — CID 39466987
2-chloro-N-[2-[di(propan-2-yl)amino]ethyl]-5-(2-phenoxyethylsulfamoyl)benzamide (PubChem CID 39466987) has the molecular formula C23H32ClN3O4S and a molecular weight of 482.05 g/mol. Its IUPAC name is 2-chloro-N-[2-[di(propan-2-yl)amino]ethyl]-5-(2-phenoxyethylsulfamoyl)benzamide.
| Compound Name | 2-chloro-N-[2-[di(propan-2-yl)amino]ethyl]-5-(2-phenoxyethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 39466987 |
| Molecular Formula | C23H32ClN3O4S |
| Molecular Weight | 482.05 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 2-chloro-N-[2-[di(propan-2-yl)amino]ethyl]-5-(2-phenoxyethylsulfamoyl)benzamide |
| SMILES | CC(C)N(CCNC(=O)c1cc(S(=O)(=O)NCCOc2ccccc2)ccc1Cl)C(C)C |
| InChI | InChI=1S/C23H32ClN3O4S/c1-17(2)27(18(3)4)14-12-25-23(28)21-16-20(10-11-22(21)24)32(29,30)26-13-15-31-19-8-6-5-7-9-19/h5-11,16-18,26H,12-15H2,1-4H3,(H,25,28) |
| InChIKey | LWIIIRIRZMYSCD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.05 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|