C18H20BrClN2O4S — CID 60549183
N-[2-(3-bromophenoxy)ethyl]-2-chloro-5-(propan-2-ylsulfamoyl)benzamide (PubChem CID 60549183) has the molecular formula C18H20BrClN2O4S and a molecular weight of 475.79 g/mol. Its IUPAC name is N-[2-(3-bromophenoxy)ethyl]-2-chloro-5-(propan-2-ylsulfamoyl)benzamide.
| Compound Name | N-[2-(3-bromophenoxy)ethyl]-2-chloro-5-(propan-2-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 60549183 |
| Molecular Formula | C18H20BrClN2O4S |
| Molecular Weight | 475.79 g/mol |
| Exact Mass | 474.00 |
| IUPAC Name | N-[2-(3-bromophenoxy)ethyl]-2-chloro-5-(propan-2-ylsulfamoyl)benzamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(Cl)c(C(=O)NCCOc2cccc(Br)c2)c1 |
| InChI | InChI=1S/C18H20BrClN2O4S/c1-12(2)22-27(24,25)15-6-7-17(20)16(11-15)18(23)21-8-9-26-14-5-3-4-13(19)10-14/h3-7,10-12,22H,8-9H2,1-2H3,(H,21,23) |
| InChIKey | GBYYDVBHJILLRV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.79 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|