C14H20ClN3O4S — CID 55406988
2-chloro-N-[2-(ethylamino)-2-oxoethyl]-5-(propan-2-ylsulfamoyl)benzamide (PubChem CID 55406988) has the molecular formula C14H20ClN3O4S and a molecular weight of 361.85 g/mol. Its IUPAC name is 2-chloro-N-[2-(ethylamino)-2-oxoethyl]-5-(propan-2-ylsulfamoyl)benzamide.
| Compound Name | 2-chloro-N-[2-(ethylamino)-2-oxoethyl]-5-(propan-2-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55406988 |
| Molecular Formula | C14H20ClN3O4S |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 2-chloro-N-[2-(ethylamino)-2-oxoethyl]-5-(propan-2-ylsulfamoyl)benzamide |
| SMILES | CCNC(=O)CNC(=O)c1cc(S(=O)(=O)NC(C)C)ccc1Cl |
| InChI | InChI=1S/C14H20ClN3O4S/c1-4-16-13(19)8-17-14(20)11-7-10(5-6-12(11)15)23(21,22)18-9(2)3/h5-7,9,18H,4,8H2,1-3H3,(H,16,19)(H,17,20) |
| InChIKey | KFDBNZYFYXWRNA-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |