C22H30ClN3O4S — CID 34056891
3-[[[2-(1-adamantyl)acetyl]amino]carbamoyl]-4-chloro-N-propan-2-ylbenzenesulfonamide (PubChem CID 34056891) has the molecular formula C22H30ClN3O4S and a molecular weight of 468.02 g/mol. Its IUPAC name is 3-[[[2-(1-adamantyl)acetyl]amino]carbamoyl]-4-chloro-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 3-[[[2-(1-adamantyl)acetyl]amino]carbamoyl]-4-chloro-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 34056891 |
| Molecular Formula | C22H30ClN3O4S |
| Molecular Weight | 468.02 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 3-[[[2-(1-adamantyl)acetyl]amino]carbamoyl]-4-chloro-N-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(Cl)c(C(=O)NNC(=O)CC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C22H30ClN3O4S/c1-13(2)26-31(29,30)17-3-4-19(23)18(8-17)21(28)25-24-20(27)12-22-9-14-5-15(10-22)7-16(6-14)11-22/h3-4,8,13-16,26H,5-7,9-12H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | VNSAWSVDWQWDPN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.02 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|