C20H26N2O6S — CID 55879812
methyl 5-[[[2-(1-adamantyl)acetyl]amino]sulfamoyl]-2-hydroxybenzoate (PubChem CID 55879812) has the molecular formula C20H26N2O6S and a molecular weight of 422.50 g/mol. Its IUPAC name is methyl 5-[[[2-(1-adamantyl)acetyl]amino]sulfamoyl]-2-hydroxybenzoate.
| Compound Name | methyl 5-[[[2-(1-adamantyl)acetyl]amino]sulfamoyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 55879812 |
| Molecular Formula | C20H26N2O6S |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | methyl 5-[[[2-(1-adamantyl)acetyl]amino]sulfamoyl]-2-hydroxybenzoate |
| SMILES | COC(=O)c1cc(S(=O)(=O)NNC(=O)CC23CC4CC(CC(C4)C2)C3)ccc1O |
| InChI | InChI=1S/C20H26N2O6S/c1-28-19(25)16-7-15(2-3-17(16)23)29(26,27)22-21-18(24)11-20-8-12-4-13(9-20)6-14(5-12)10-20/h2-3,7,12-14,22-23H,4-6,8-11H2,1H3,(H,21,24) |
| InChIKey | LEDLVDQOQCODDR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|