C20H26N2O4S — CID 26983030
N'-(3-acetylphenyl)sulfonyl-2-(1-adamantyl)acetohydrazide (PubChem CID 26983030) has the molecular formula C20H26N2O4S and a molecular weight of 390.51 g/mol. Its IUPAC name is N'-(3-acetylphenyl)sulfonyl-2-(1-adamantyl)acetohydrazide.
| Compound Name | N'-(3-acetylphenyl)sulfonyl-2-(1-adamantyl)acetohydrazide |
|---|---|
| PubChem CID | 26983030 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N'-(3-acetylphenyl)sulfonyl-2-(1-adamantyl)acetohydrazide |
| SMILES | CC(=O)c1cccc(S(=O)(=O)NNC(=O)CC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C20H26N2O4S/c1-13(23)17-3-2-4-18(8-17)27(25,26)22-21-19(24)12-20-9-14-5-15(10-20)7-16(6-14)11-20/h2-4,8,14-16,22H,5-7,9-12H2,1H3,(H,21,24) |
| InChIKey | CANXNUNGDZIGSV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|