C21H28N2O5S — CID 8616538
2-(1-adamantyl)-N'-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)acetohydrazide (PubChem CID 8616538) has the molecular formula C21H28N2O5S and a molecular weight of 420.53 g/mol. Its IUPAC name is 2-(1-adamantyl)-N'-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)acetohydrazide.
| Compound Name | 2-(1-adamantyl)-N'-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)acetohydrazide |
|---|---|
| PubChem CID | 8616538 |
| Molecular Formula | C21H28N2O5S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 2-(1-adamantyl)-N'-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)acetohydrazide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)NNS(=O)(=O)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C21H28N2O5S/c24-20(13-21-10-14-6-15(11-21)8-16(7-14)12-21)22-23-29(25,26)17-2-3-18-19(9-17)28-5-1-4-27-18/h2-3,9,14-16,23H,1,4-8,10-13H2,(H,22,24) |
| InChIKey | LZUPISBVAFEDCJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|