C18H22ClFN2O3S — CID 8616537
2-(1-adamantyl)-N'-(4-chloro-2-fluorophenyl)sulfonylacetohydrazide (PubChem CID 8616537) has the molecular formula C18H22ClFN2O3S and a molecular weight of 400.90 g/mol. Its IUPAC name is 2-(1-adamantyl)-N'-(4-chloro-2-fluorophenyl)sulfonylacetohydrazide.
| Compound Name | 2-(1-adamantyl)-N'-(4-chloro-2-fluorophenyl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 8616537 |
| Molecular Formula | C18H22ClFN2O3S |
| Molecular Weight | 400.90 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 2-(1-adamantyl)-N'-(4-chloro-2-fluorophenyl)sulfonylacetohydrazide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)NNS(=O)(=O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C18H22ClFN2O3S/c19-14-1-2-16(15(20)6-14)26(24,25)22-21-17(23)10-18-7-11-3-12(8-18)5-13(4-11)9-18/h1-2,6,11-13,22H,3-5,7-10H2,(H,21,23) |
| InChIKey | SHXOFFYDAYSZFN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.90 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|