C21H26F2N2O2 — CID 55605333
N'-[2-(1-adamantyl)acetyl]-3-(3,4-difluorophenyl)propanehydrazide (PubChem CID 55605333) has the molecular formula C21H26F2N2O2 and a molecular weight of 376.45 g/mol. Its IUPAC name is N'-[2-(1-adamantyl)acetyl]-3-(3,4-difluorophenyl)propanehydrazide.
| Compound Name | N'-[2-(1-adamantyl)acetyl]-3-(3,4-difluorophenyl)propanehydrazide |
|---|---|
| PubChem CID | 55605333 |
| Molecular Formula | C21H26F2N2O2 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | N'-[2-(1-adamantyl)acetyl]-3-(3,4-difluorophenyl)propanehydrazide |
| SMILES | O=C(CCc1ccc(F)c(F)c1)NNC(=O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H26F2N2O2/c22-17-3-1-13(8-18(17)23)2-4-19(26)24-25-20(27)12-21-9-14-5-15(10-21)7-16(6-14)11-21/h1,3,8,14-16H,2,4-7,9-12H2,(H,24,26)(H,25,27) |
| InChIKey | CGWKGILIVITYNY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|