C18H21F2NO — CID 2741131
2-(1-adamantyl)-N-(2,6-difluorophenyl)acetamide (PubChem CID 2741131) has the molecular formula C18H21F2NO and a molecular weight of 305.37 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-(2,6-difluorophenyl)acetamide.
| Compound Name | 2-(1-adamantyl)-N-(2,6-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 2741131 |
| Molecular Formula | C18H21F2NO |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-(1-adamantyl)-N-(2,6-difluorophenyl)acetamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)Nc1c(F)cccc1F |
| InChI | InChI=1S/C18H21F2NO/c19-14-2-1-3-15(20)17(14)21-16(22)10-18-7-11-4-12(8-18)6-13(5-11)9-18/h1-3,11-13H,4-10H2,(H,21,22) |
| InChIKey | BLMUFIFQVQXQOY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |