C18H21Cl2NO — CID 3436472
2-(1-adamantyl)-N-(3,5-dichlorophenyl)acetamide (PubChem CID 3436472) has the molecular formula C18H21Cl2NO and a molecular weight of 338.28 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-(3,5-dichlorophenyl)acetamide.
| Compound Name | 2-(1-adamantyl)-N-(3,5-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 3436472 |
| Molecular Formula | C18H21Cl2NO |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 2-(1-adamantyl)-N-(3,5-dichlorophenyl)acetamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H21Cl2NO/c19-14-4-15(20)6-16(5-14)21-17(22)10-18-7-11-1-12(8-18)3-13(2-11)9-18/h4-6,11-13H,1-3,7-10H2,(H,21,22) |
| InChIKey | CBQJWZHILNHBAX-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |