C17H22ClN3O2 — CID 35766957
N'-[2-(1-adamantyl)acetyl]-4-chloro-1H-pyrrole-2-carbohydrazide (PubChem CID 35766957) has the molecular formula C17H22ClN3O2 and a molecular weight of 335.84 g/mol. Its IUPAC name is N'-[2-(1-adamantyl)acetyl]-4-chloro-1H-pyrrole-2-carbohydrazide.
| Compound Name | N'-[2-(1-adamantyl)acetyl]-4-chloro-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 35766957 |
| Molecular Formula | C17H22ClN3O2 |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | N'-[2-(1-adamantyl)acetyl]-4-chloro-1H-pyrrole-2-carbohydrazide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)NNC(=O)c1cc(Cl)c[nH]1 |
| InChI | InChI=1S/C17H22ClN3O2/c18-13-4-14(19-9-13)16(23)21-20-15(22)8-17-5-10-1-11(6-17)3-12(2-10)7-17/h4,9-12,19H,1-3,5-8H2,(H,20,22)(H,21,23) |
| InChIKey | DXZAMYFTKPUPQQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|