C13H11ClFN3O2 — CID 31726060
4-chloro-N'-[2-(4-fluorophenyl)acetyl]-1H-pyrrole-2-carbohydrazide (PubChem CID 31726060) has the molecular formula C13H11ClFN3O2 and a molecular weight of 295.70 g/mol. Its IUPAC name is 4-chloro-N'-[2-(4-fluorophenyl)acetyl]-1H-pyrrole-2-carbohydrazide.
| Compound Name | 4-chloro-N'-[2-(4-fluorophenyl)acetyl]-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 31726060 |
| Molecular Formula | C13H11ClFN3O2 |
| Molecular Weight | 295.70 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 4-chloro-N'-[2-(4-fluorophenyl)acetyl]-1H-pyrrole-2-carbohydrazide |
| SMILES | O=C(Cc1ccc(F)cc1)NNC(=O)c1cc(Cl)c[nH]1 |
| InChI | InChI=1S/C13H11ClFN3O2/c14-9-6-11(16-7-9)13(20)18-17-12(19)5-8-1-3-10(15)4-2-8/h1-4,6-7,16H,5H2,(H,17,19)(H,18,20) |
| InChIKey | RVVQJZDJPLOIDJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.70 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|