C15H15BrN4O3 — CID 31598614
N-[4-[2-[2-(4-bromo-1H-pyrrole-2-carbonyl)hydrazinyl]-2-oxoethyl]phenyl]acetamide (PubChem CID 31598614) has the molecular formula C15H15BrN4O3 and a molecular weight of 379.21 g/mol. Its IUPAC name is N-[4-[2-[2-(4-bromo-1H-pyrrole-2-carbonyl)hydrazinyl]-2-oxoethyl]phenyl]acetamide.
| Compound Name | N-[4-[2-[2-(4-bromo-1H-pyrrole-2-carbonyl)hydrazinyl]-2-oxoethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 31598614 |
| Molecular Formula | C15H15BrN4O3 |
| Molecular Weight | 379.21 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | N-[4-[2-[2-(4-bromo-1H-pyrrole-2-carbonyl)hydrazinyl]-2-oxoethyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CC(=O)NNC(=O)c2cc(Br)c[nH]2)cc1 |
| InChI | InChI=1S/C15H15BrN4O3/c1-9(21)18-12-4-2-10(3-5-12)6-14(22)19-20-15(23)13-7-11(16)8-17-13/h2-5,7-8,17H,6H2,1H3,(H,18,21)(H,19,22)(H,20,23) |
| InChIKey | RUQNWUGTQRODBE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.21 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|