C23H25BrN4O — CID 55850060
N-[4-[(4-benzylpiperazin-1-yl)methyl]phenyl]-4-bromo-1H-pyrrole-2-carboxamide (PubChem CID 55850060) has the molecular formula C23H25BrN4O and a molecular weight of 453.38 g/mol. Its IUPAC name is N-[4-[(4-benzylpiperazin-1-yl)methyl]phenyl]-4-bromo-1H-pyrrole-2-carboxamide.
| Compound Name | N-[4-[(4-benzylpiperazin-1-yl)methyl]phenyl]-4-bromo-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 55850060 |
| Molecular Formula | C23H25BrN4O |
| Molecular Weight | 453.38 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | N-[4-[(4-benzylpiperazin-1-yl)methyl]phenyl]-4-bromo-1H-pyrrole-2-carboxamide |
| SMILES | O=C(Nc1ccc(CN2CCN(Cc3ccccc3)CC2)cc1)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C23H25BrN4O/c24-20-14-22(25-15-20)23(29)26-21-8-6-19(7-9-21)17-28-12-10-27(11-13-28)16-18-4-2-1-3-5-18/h1-9,14-15,25H,10-13,16-17H2,(H,26,29) |
| InChIKey | QEANJUDFWUETKO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |