C27H31N5O2 — CID 60510762
N-[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]-4-(phenylcarbamoylamino)benzamide (PubChem CID 60510762) has the molecular formula C27H31N5O2 and a molecular weight of 457.58 g/mol. Its IUPAC name is N-[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]-4-(phenylcarbamoylamino)benzamide.
| Compound Name | N-[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]-4-(phenylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 60510762 |
| Molecular Formula | C27H31N5O2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | N-[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]-4-(phenylcarbamoylamino)benzamide |
| SMILES | CCN1CCN(Cc2ccc(NC(=O)c3ccc(NC(=O)Nc4ccccc4)cc3)cc2)CC1 |
| InChI | InChI=1S/C27H31N5O2/c1-2-31-16-18-32(19-17-31)20-21-8-12-24(13-9-21)28-26(33)22-10-14-25(15-11-22)30-27(34)29-23-6-4-3-5-7-23/h3-15H,2,16-20H2,1H3,(H,28,33)(H2,29,30,34) |
| InChIKey | JNVWRSYPEDCBOJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |