C19H22ClN3O3S — CID 43919467
N-(4-chlorophenyl)-4-[(4-methylsulfonylpiperazin-1-yl)methyl]benzamide (PubChem CID 43919467) has the molecular formula C19H22ClN3O3S and a molecular weight of 407.92 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[(4-methylsulfonylpiperazin-1-yl)methyl]benzamide.
| Compound Name | N-(4-chlorophenyl)-4-[(4-methylsulfonylpiperazin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 43919467 |
| Molecular Formula | C19H22ClN3O3S |
| Molecular Weight | 407.92 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | N-(4-chlorophenyl)-4-[(4-methylsulfonylpiperazin-1-yl)methyl]benzamide |
| SMILES | CS(=O)(=O)N1CCN(Cc2ccc(C(=O)Nc3ccc(Cl)cc3)cc2)CC1 |
| InChI | InChI=1S/C19H22ClN3O3S/c1-27(25,26)23-12-10-22(11-13-23)14-15-2-4-16(5-3-15)19(24)21-18-8-6-17(20)7-9-18/h2-9H,10-14H2,1H3,(H,21,24) |
| InChIKey | GHHWOGBQZKMMQQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.92 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |