C20H24ClN3O4S — CID 10071792
2-[4-[[4-[(4-chlorophenyl)carbamoyl]phenyl]methyl]piperazin-1-yl]ethanesulfonic acid (PubChem CID 10071792) has the molecular formula C20H24ClN3O4S and a molecular weight of 437.95 g/mol. Its IUPAC name is 2-[4-[[4-[(4-chlorophenyl)carbamoyl]phenyl]methyl]piperazin-1-yl]ethanesulfonic acid.
| Compound Name | 2-[4-[[4-[(4-chlorophenyl)carbamoyl]phenyl]methyl]piperazin-1-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 10071792 |
| Molecular Formula | C20H24ClN3O4S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 2-[4-[[4-[(4-chlorophenyl)carbamoyl]phenyl]methyl]piperazin-1-yl]ethanesulfonic acid |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1ccc(CN2CCN(CCS(=O)(=O)O)CC2)cc1 |
| InChI | InChI=1S/C20H24ClN3O4S/c21-18-5-7-19(8-6-18)22-20(25)17-3-1-16(2-4-17)15-24-11-9-23(10-12-24)13-14-29(26,27)28/h1-8H,9-15H2,(H,22,25)(H,26,27,28) |
| InChIKey | DZXNJLGZNQSYKK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|