C24H31N3O5S — CID 38101943
butyl 4-[[4-[(4-methylsulfonylpiperazin-1-yl)methyl]benzoyl]amino]benzoate (PubChem CID 38101943) has the molecular formula C24H31N3O5S and a molecular weight of 473.60 g/mol. Its IUPAC name is butyl 4-[[4-[(4-methylsulfonylpiperazin-1-yl)methyl]benzoyl]amino]benzoate.
| Compound Name | butyl 4-[[4-[(4-methylsulfonylpiperazin-1-yl)methyl]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 38101943 |
| Molecular Formula | C24H31N3O5S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | butyl 4-[[4-[(4-methylsulfonylpiperazin-1-yl)methyl]benzoyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)c2ccc(CN3CCN(S(C)(=O)=O)CC3)cc2)cc1 |
| InChI | InChI=1S/C24H31N3O5S/c1-3-4-17-32-24(29)21-9-11-22(12-10-21)25-23(28)20-7-5-19(6-8-20)18-26-13-15-27(16-14-26)33(2,30)31/h5-12H,3-4,13-18H2,1-2H3,(H,25,28) |
| InChIKey | SSFTXHXZEFANEM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|