C29H33N3O5S — CID 43925792
butyl 4-[[4-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]benzoyl]amino]benzoate (PubChem CID 43925792) has the molecular formula C29H33N3O5S and a molecular weight of 535.67 g/mol. Its IUPAC name is butyl 4-[[4-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]benzoyl]amino]benzoate.
| Compound Name | butyl 4-[[4-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 43925792 |
| Molecular Formula | C29H33N3O5S |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | butyl 4-[[4-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]benzoyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)c2ccc(CN3CCN(S(=O)(=O)c4ccccc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C29H33N3O5S/c1-2-3-21-37-29(34)25-13-15-26(16-14-25)30-28(33)24-11-9-23(10-12-24)22-31-17-19-32(20-18-31)38(35,36)27-7-5-4-6-8-27/h4-16H,2-3,17-22H2,1H3,(H,30,33) |
| InChIKey | GVXGBSJOTTUYKJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|