C27H28ClN3O5S — CID 46777146
ethyl 4-[[4-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]benzoyl]amino]-2-chlorobenzoate (PubChem CID 46777146) has the molecular formula C27H28ClN3O5S and a molecular weight of 542.06 g/mol. Its IUPAC name is ethyl 4-[[4-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]benzoyl]amino]-2-chlorobenzoate.
| Compound Name | ethyl 4-[[4-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]benzoyl]amino]-2-chlorobenzoate |
|---|---|
| PubChem CID | 46777146 |
| Molecular Formula | C27H28ClN3O5S |
| Molecular Weight | 542.06 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | ethyl 4-[[4-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]benzoyl]amino]-2-chlorobenzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2ccc(CN3CCN(S(=O)(=O)c4ccccc4)CC3)cc2)cc1Cl |
| InChI | InChI=1S/C27H28ClN3O5S/c1-2-36-27(33)24-13-12-22(18-25(24)28)29-26(32)21-10-8-20(9-11-21)19-30-14-16-31(17-15-30)37(34,35)23-6-4-3-5-7-23/h3-13,18H,2,14-17,19H2,1H3,(H,29,32) |
| InChIKey | KCVXJJQBTIAFBS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.06 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |