C28H27N3O3S — CID 43919632
4-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-N-naphthalen-2-ylbenzamide (PubChem CID 43919632) has the molecular formula C28H27N3O3S and a molecular weight of 485.61 g/mol. Its IUPAC name is 4-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-N-naphthalen-2-ylbenzamide.
| Compound Name | 4-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-N-naphthalen-2-ylbenzamide |
|---|---|
| PubChem CID | 43919632 |
| Molecular Formula | C28H27N3O3S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 4-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-N-naphthalen-2-ylbenzamide |
| SMILES | O=C(Nc1ccc2ccccc2c1)c1ccc(CN2CCN(S(=O)(=O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C28H27N3O3S/c32-28(29-26-15-14-23-6-4-5-7-25(23)20-26)24-12-10-22(11-13-24)21-30-16-18-31(19-17-30)35(33,34)27-8-2-1-3-9-27/h1-15,20H,16-19,21H2,(H,29,32) |
| InChIKey | DATOAIZGKHSOMC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |