C24H31N5O2 — CID 55911957
3-(cyclopropylcarbamoylamino)-N-[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]benzamide (PubChem CID 55911957) has the molecular formula C24H31N5O2 and a molecular weight of 421.55 g/mol. Its IUPAC name is 3-(cyclopropylcarbamoylamino)-N-[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]benzamide.
| Compound Name | 3-(cyclopropylcarbamoylamino)-N-[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 55911957 |
| Molecular Formula | C24H31N5O2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | 3-(cyclopropylcarbamoylamino)-N-[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]benzamide |
| SMILES | CCN1CCN(Cc2ccc(NC(=O)c3cccc(NC(=O)NC4CC4)c3)cc2)CC1 |
| InChI | InChI=1S/C24H31N5O2/c1-2-28-12-14-29(15-13-28)17-18-6-8-20(9-7-18)25-23(30)19-4-3-5-22(16-19)27-24(31)26-21-10-11-21/h3-9,16,21H,2,10-15,17H2,1H3,(H,25,30)(H2,26,27,31) |
| InChIKey | HSZFJORCVKJRDF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |