C29H30N4O3 — CID 60510389
3-[(1,3-dioxoisoindol-2-yl)methyl]-N-[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]benzamide (PubChem CID 60510389) has the molecular formula C29H30N4O3 and a molecular weight of 482.58 g/mol. Its IUPAC name is 3-[(1,3-dioxoisoindol-2-yl)methyl]-N-[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]benzamide.
| Compound Name | 3-[(1,3-dioxoisoindol-2-yl)methyl]-N-[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 60510389 |
| Molecular Formula | C29H30N4O3 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 3-[(1,3-dioxoisoindol-2-yl)methyl]-N-[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]benzamide |
| SMILES | CCN1CCN(Cc2ccc(NC(=O)c3cccc(CN4C(=O)c5ccccc5C4=O)c3)cc2)CC1 |
| InChI | InChI=1S/C29H30N4O3/c1-2-31-14-16-32(17-15-31)19-21-10-12-24(13-11-21)30-27(34)23-7-5-6-22(18-23)20-33-28(35)25-8-3-4-9-26(25)29(33)36/h3-13,18H,2,14-17,19-20H2,1H3,(H,30,34) |
| InChIKey | TVHYMBGGOYNWRJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|