C22H15ClN2O3 — CID 8762375
N-(4-chlorophenyl)-3-[(1,3-dioxoisoindol-2-yl)methyl]benzamide (PubChem CID 8762375) has the molecular formula C22H15ClN2O3 and a molecular weight of 390.83 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3-[(1,3-dioxoisoindol-2-yl)methyl]benzamide.
| Compound Name | N-(4-chlorophenyl)-3-[(1,3-dioxoisoindol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 8762375 |
| Molecular Formula | C22H15ClN2O3 |
| Molecular Weight | 390.83 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | N-(4-chlorophenyl)-3-[(1,3-dioxoisoindol-2-yl)methyl]benzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1cccc(CN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C22H15ClN2O3/c23-16-8-10-17(11-9-16)24-20(26)15-5-3-4-14(12-15)13-25-21(27)18-6-1-2-7-19(18)22(25)28/h1-12H,13H2,(H,24,26) |
| InChIKey | WHUVEKAHNCXZSL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.83 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|