C25H19ClN2O3 — CID 155528656
3-[(E)-(1-benzyl-2,5-dioxopyrrolidin-3-ylidene)methyl]-N-(4-chlorophenyl)benzamide (PubChem CID 155528656) has the molecular formula C25H19ClN2O3 and a molecular weight of 430.89 g/mol. Its IUPAC name is 3-[(E)-(1-benzyl-2,5-dioxopyrrolidin-3-ylidene)methyl]-N-(4-chlorophenyl)benzamide.
| Compound Name | 3-[(E)-(1-benzyl-2,5-dioxopyrrolidin-3-ylidene)methyl]-N-(4-chlorophenyl)benzamide |
|---|---|
| PubChem CID | 155528656 |
| Molecular Formula | C25H19ClN2O3 |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 3-[(E)-(1-benzyl-2,5-dioxopyrrolidin-3-ylidene)methyl]-N-(4-chlorophenyl)benzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1cccc(/C=C2\CC(=O)N(Cc3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C25H19ClN2O3/c26-21-9-11-22(12-10-21)27-24(30)19-8-4-7-18(13-19)14-20-15-23(29)28(25(20)31)16-17-5-2-1-3-6-17/h1-14H,15-16H2,(H,27,30)/b20-14+ |
| InChIKey | YZALBOXSBIGLBY-XSFVSMFZSA-N |
| XLogP | 4.93 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|