C24H19ClN4O5S — CID 1194898
3-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]-N-(4-sulfamoylphenyl)benzamide (PubChem CID 1194898) has the molecular formula C24H19ClN4O5S and a molecular weight of 510.96 g/mol. Its IUPAC name is 3-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]-N-(4-sulfamoylphenyl)benzamide.
| Compound Name | 3-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]-N-(4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 1194898 |
| Molecular Formula | C24H19ClN4O5S |
| Molecular Weight | 510.96 g/mol |
| Exact Mass | 510.08 |
| IUPAC Name | 3-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]-N-(4-sulfamoylphenyl)benzamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2cccc(NC3=C(Cl)C(=O)N(Cc4ccccc4)C3=O)c2)cc1 |
| InChI | InChI=1S/C24H19ClN4O5S/c25-20-21(24(32)29(23(20)31)14-15-5-2-1-3-6-15)27-18-8-4-7-16(13-18)22(30)28-17-9-11-19(12-10-17)35(26,33)34/h1-13,27H,14H2,(H,28,30)(H2,26,33,34) |
| InChIKey | XVTAYNAPIJFSHK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.96 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|