C24H17Cl2N3O3 — CID 1194953
4-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]-N-(3-chlorophenyl)benzamide (PubChem CID 1194953) has the molecular formula C24H17Cl2N3O3 and a molecular weight of 466.32 g/mol. Its IUPAC name is 4-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]-N-(3-chlorophenyl)benzamide.
| Compound Name | 4-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]-N-(3-chlorophenyl)benzamide |
|---|---|
| PubChem CID | 1194953 |
| Molecular Formula | C24H17Cl2N3O3 |
| Molecular Weight | 466.32 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | 4-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]-N-(3-chlorophenyl)benzamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1ccc(NC2=C(Cl)C(=O)N(Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C24H17Cl2N3O3/c25-17-7-4-8-19(13-17)28-22(30)16-9-11-18(12-10-16)27-21-20(26)23(31)29(24(21)32)14-15-5-2-1-3-6-15/h1-13,27H,14H2,(H,28,30) |
| InChIKey | YBYSBVXYNRCLBH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.32 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|