C24H17ClIN3O3 — CID 1194956
4-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]-N-(4-iodophenyl)benzamide (PubChem CID 1194956) has the molecular formula C24H17ClIN3O3 and a molecular weight of 557.78 g/mol. Its IUPAC name is 4-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]-N-(4-iodophenyl)benzamide.
| Compound Name | 4-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]-N-(4-iodophenyl)benzamide |
|---|---|
| PubChem CID | 1194956 |
| Molecular Formula | C24H17ClIN3O3 |
| Molecular Weight | 557.78 g/mol |
| Exact Mass | 557.00 |
| IUPAC Name | 4-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]-N-(4-iodophenyl)benzamide |
| SMILES | O=C(Nc1ccc(I)cc1)c1ccc(NC2=C(Cl)C(=O)N(Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C24H17ClIN3O3/c25-20-21(24(32)29(23(20)31)14-15-4-2-1-3-5-15)27-18-10-6-16(7-11-18)22(30)28-19-12-8-17(26)9-13-19/h1-13,27H,14H2,(H,28,30) |
| InChIKey | BHQUMSZSISKJEY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.78 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|