C26H22ClN3O4 — CID 1194917
4-[[4-chloro-2,5-dioxo-1-(2-phenylethyl)pyrrol-3-yl]amino]-N-(2-methoxyphenyl)benzamide (PubChem CID 1194917) has the molecular formula C26H22ClN3O4 and a molecular weight of 475.93 g/mol. Its IUPAC name is 4-[[4-chloro-2,5-dioxo-1-(2-phenylethyl)pyrrol-3-yl]amino]-N-(2-methoxyphenyl)benzamide.
| Compound Name | 4-[[4-chloro-2,5-dioxo-1-(2-phenylethyl)pyrrol-3-yl]amino]-N-(2-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 1194917 |
| Molecular Formula | C26H22ClN3O4 |
| Molecular Weight | 475.93 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | 4-[[4-chloro-2,5-dioxo-1-(2-phenylethyl)pyrrol-3-yl]amino]-N-(2-methoxyphenyl)benzamide |
| SMILES | COc1ccccc1NC(=O)c1ccc(NC2=C(Cl)C(=O)N(CCc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C26H22ClN3O4/c1-34-21-10-6-5-9-20(21)29-24(31)18-11-13-19(14-12-18)28-23-22(27)25(32)30(26(23)33)16-15-17-7-3-2-4-8-17/h2-14,28H,15-16H2,1H3,(H,29,31) |
| InChIKey | BMJYAURIVDSWOI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.93 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|