C27H24ClN3O3 — CID 1178256
4-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]-N-(2,4,6-trimethylphenyl)benzamide (PubChem CID 1178256) has the molecular formula C27H24ClN3O3 and a molecular weight of 473.96 g/mol. Its IUPAC name is 4-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]-N-(2,4,6-trimethylphenyl)benzamide.
| Compound Name | 4-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]-N-(2,4,6-trimethylphenyl)benzamide |
|---|---|
| PubChem CID | 1178256 |
| Molecular Formula | C27H24ClN3O3 |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 4-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]-N-(2,4,6-trimethylphenyl)benzamide |
| SMILES | Cc1cc(C)c(NC(=O)c2ccc(NC3=C(Cl)C(=O)N(Cc4ccccc4)C3=O)cc2)c(C)c1 |
| InChI | InChI=1S/C27H24ClN3O3/c1-16-13-17(2)23(18(3)14-16)30-25(32)20-9-11-21(12-10-20)29-24-22(28)26(33)31(27(24)34)15-19-7-5-4-6-8-19/h4-14,29H,15H2,1-3H3,(H,30,32) |
| InChIKey | NUNBWQYUOMXVCM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|