C26H19ClF3N3O3 — CID 1407639
3-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]-4-methyl-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 1407639) has the molecular formula C26H19ClF3N3O3 and a molecular weight of 513.90 g/mol. Its IUPAC name is 3-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]-4-methyl-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]-4-methyl-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 1407639 |
| Molecular Formula | C26H19ClF3N3O3 |
| Molecular Weight | 513.90 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | 3-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]-4-methyl-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(C(F)(F)F)c2)cc1NC1=C(Cl)C(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C26H19ClF3N3O3/c1-15-10-11-17(23(34)31-19-9-5-8-18(13-19)26(28,29)30)12-20(15)32-22-21(27)24(35)33(25(22)36)14-16-6-3-2-4-7-16/h2-13,32H,14H2,1H3,(H,31,34) |
| InChIKey | RYWYHOFTRFCGBQ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.90 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|