C24H24ClN3O3 — CID 1407652
3-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]-N-cyclopentyl-4-methylbenzamide (PubChem CID 1407652) has the molecular formula C24H24ClN3O3 and a molecular weight of 437.93 g/mol. Its IUPAC name is 3-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]-N-cyclopentyl-4-methylbenzamide.
| Compound Name | 3-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]-N-cyclopentyl-4-methylbenzamide |
|---|---|
| PubChem CID | 1407652 |
| Molecular Formula | C24H24ClN3O3 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 3-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]-N-cyclopentyl-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC2CCCC2)cc1NC1=C(Cl)C(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C24H24ClN3O3/c1-15-11-12-17(22(29)26-18-9-5-6-10-18)13-19(15)27-21-20(25)23(30)28(24(21)31)14-16-7-3-2-4-8-16/h2-4,7-8,11-13,18,27H,5-6,9-10,14H2,1H3,(H,26,29) |
| InChIKey | DXOWKMPXNADHKD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|