C26H28ClN3O3 — CID 1407853
3-[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]-4-methyl-N-(2-phenylethyl)benzamide (PubChem CID 1407853) has the molecular formula C26H28ClN3O3 and a molecular weight of 465.98 g/mol. Its IUPAC name is 3-[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]-4-methyl-N-(2-phenylethyl)benzamide.
| Compound Name | 3-[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]-4-methyl-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 1407853 |
| Molecular Formula | C26H28ClN3O3 |
| Molecular Weight | 465.98 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 3-[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]-4-methyl-N-(2-phenylethyl)benzamide |
| SMILES | Cc1ccc(C(=O)NCCc2ccccc2)cc1NC1=C(Cl)C(=O)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C26H28ClN3O3/c1-17-12-13-19(24(31)28-15-14-18-8-4-2-5-9-18)16-21(17)29-23-22(27)25(32)30(26(23)33)20-10-6-3-7-11-20/h2,4-5,8-9,12-13,16,20,29H,3,6-7,10-11,14-15H2,1H3,(H,28,31) |
| InChIKey | MSLPGSASXWKJGX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.98 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|