C25H26ClN3O3 — CID 4110970
4-[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]-N-(1-phenylethyl)benzamide (PubChem CID 4110970) has the molecular formula C25H26ClN3O3 and a molecular weight of 451.95 g/mol. Its IUPAC name is 4-[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]-N-(1-phenylethyl)benzamide.
| Compound Name | 4-[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 4110970 |
| Molecular Formula | C25H26ClN3O3 |
| Molecular Weight | 451.95 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 4-[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]-N-(1-phenylethyl)benzamide |
| SMILES | CC(NC(=O)c1ccc(NC2=C(Cl)C(=O)N(C3CCCCC3)C2=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H26ClN3O3/c1-16(17-8-4-2-5-9-17)27-23(30)18-12-14-19(15-13-18)28-22-21(26)24(31)29(25(22)32)20-10-6-3-7-11-20/h2,4-5,8-9,12-16,20,28H,3,6-7,10-11H2,1H3,(H,27,30) |
| InChIKey | WCDPQKKOVYKKDP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.95 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|