C25H19Cl2N3O3 — CID 5071532
4-[[4-chloro-1-(3-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]-N-(1-phenylethyl)benzamide (PubChem CID 5071532) has the molecular formula C25H19Cl2N3O3 and a molecular weight of 480.35 g/mol. Its IUPAC name is 4-[[4-chloro-1-(3-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]-N-(1-phenylethyl)benzamide.
| Compound Name | 4-[[4-chloro-1-(3-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 5071532 |
| Molecular Formula | C25H19Cl2N3O3 |
| Molecular Weight | 480.35 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | 4-[[4-chloro-1-(3-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]-N-(1-phenylethyl)benzamide |
| SMILES | CC(NC(=O)c1ccc(NC2=C(Cl)C(=O)N(c3cccc(Cl)c3)C2=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H19Cl2N3O3/c1-15(16-6-3-2-4-7-16)28-23(31)17-10-12-19(13-11-17)29-22-21(27)24(32)30(25(22)33)20-9-5-8-18(26)14-20/h2-15,29H,1H3,(H,28,31) |
| InChIKey | BZFHLASBIODPSA-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.35 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|