C17H10Cl2N2O4 — CID 1185314
3-[[4-chloro-1-(3-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid (PubChem CID 1185314) has the molecular formula C17H10Cl2N2O4 and a molecular weight of 377.18 g/mol. Its IUPAC name is 3-[[4-chloro-1-(3-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid.
| Compound Name | 3-[[4-chloro-1-(3-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 1185314 |
| Molecular Formula | C17H10Cl2N2O4 |
| Molecular Weight | 377.18 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | 3-[[4-chloro-1-(3-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid |
| SMILES | O=C(O)c1cccc(NC2=C(Cl)C(=O)N(c3cccc(Cl)c3)C2=O)c1 |
| InChI | InChI=1S/C17H10Cl2N2O4/c18-10-4-2-6-12(8-10)21-15(22)13(19)14(16(21)23)20-11-5-1-3-9(7-11)17(24)25/h1-8,20H,(H,24,25) |
| InChIKey | FUKJETUMMNAUME-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.18 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|