C19H15ClN2O5 — CID 1192237
methyl 4-[3-chloro-4-(3-methoxyanilino)-2,5-dioxopyrrol-1-yl]benzoate (PubChem CID 1192237) has the molecular formula C19H15ClN2O5 and a molecular weight of 386.79 g/mol. Its IUPAC name is methyl 4-[3-chloro-4-(3-methoxyanilino)-2,5-dioxopyrrol-1-yl]benzoate.
| Compound Name | methyl 4-[3-chloro-4-(3-methoxyanilino)-2,5-dioxopyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 1192237 |
| Molecular Formula | C19H15ClN2O5 |
| Molecular Weight | 386.79 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | methyl 4-[3-chloro-4-(3-methoxyanilino)-2,5-dioxopyrrol-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)C(Cl)=C(Nc3cccc(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C19H15ClN2O5/c1-26-14-5-3-4-12(10-14)21-16-15(20)17(23)22(18(16)24)13-8-6-11(7-9-13)19(25)27-2/h3-10,21H,1-2H3 |
| InChIKey | UBUNGVWKUHQCPD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.79 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|