C26H22ClN3O4 — CID 1407534
3-[[4-chloro-1-(4-methylphenyl)-2,5-dioxopyrrol-3-yl]amino]-N-(3-methoxyphenyl)-4-methylbenzamide (PubChem CID 1407534) has the molecular formula C26H22ClN3O4 and a molecular weight of 475.93 g/mol. Its IUPAC name is 3-[[4-chloro-1-(4-methylphenyl)-2,5-dioxopyrrol-3-yl]amino]-N-(3-methoxyphenyl)-4-methylbenzamide.
| Compound Name | 3-[[4-chloro-1-(4-methylphenyl)-2,5-dioxopyrrol-3-yl]amino]-N-(3-methoxyphenyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 1407534 |
| Molecular Formula | C26H22ClN3O4 |
| Molecular Weight | 475.93 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | 3-[[4-chloro-1-(4-methylphenyl)-2,5-dioxopyrrol-3-yl]amino]-N-(3-methoxyphenyl)-4-methylbenzamide |
| SMILES | COc1cccc(NC(=O)c2ccc(C)c(NC3=C(Cl)C(=O)N(c4ccc(C)cc4)C3=O)c2)c1 |
| InChI | InChI=1S/C26H22ClN3O4/c1-15-7-11-19(12-8-15)30-25(32)22(27)23(26(30)33)29-21-13-17(10-9-16(21)2)24(31)28-18-5-4-6-20(14-18)34-3/h4-14,29H,1-3H3,(H,28,31) |
| InChIKey | AFCOFHBYNVFYGR-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.93 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|