C26H21Cl2N3O4 — CID 1407604
3-[[4-chloro-1-(4-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]-N-(4-ethoxyphenyl)-4-methylbenzamide (PubChem CID 1407604) has the molecular formula C26H21Cl2N3O4 and a molecular weight of 510.38 g/mol. Its IUPAC name is 3-[[4-chloro-1-(4-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]-N-(4-ethoxyphenyl)-4-methylbenzamide.
| Compound Name | 3-[[4-chloro-1-(4-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]-N-(4-ethoxyphenyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 1407604 |
| Molecular Formula | C26H21Cl2N3O4 |
| Molecular Weight | 510.38 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | 3-[[4-chloro-1-(4-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]-N-(4-ethoxyphenyl)-4-methylbenzamide |
| SMILES | CCOc1ccc(NC(=O)c2ccc(C)c(NC3=C(Cl)C(=O)N(c4ccc(Cl)cc4)C3=O)c2)cc1 |
| InChI | InChI=1S/C26H21Cl2N3O4/c1-3-35-20-12-8-18(9-13-20)29-24(32)16-5-4-15(2)21(14-16)30-23-22(28)25(33)31(26(23)34)19-10-6-17(27)7-11-19/h4-14,30H,3H2,1-2H3,(H,29,32) |
| InChIKey | DBEZXDBVIKAPNB-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.38 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|