C26H22ClN3O3 — CID 1407541
3-[[4-chloro-1-(4-methylphenyl)-2,5-dioxopyrrol-3-yl]amino]-4-methyl-N-(2-methylphenyl)benzamide (PubChem CID 1407541) has the molecular formula C26H22ClN3O3 and a molecular weight of 459.93 g/mol. Its IUPAC name is 3-[[4-chloro-1-(4-methylphenyl)-2,5-dioxopyrrol-3-yl]amino]-4-methyl-N-(2-methylphenyl)benzamide.
| Compound Name | 3-[[4-chloro-1-(4-methylphenyl)-2,5-dioxopyrrol-3-yl]amino]-4-methyl-N-(2-methylphenyl)benzamide |
|---|---|
| PubChem CID | 1407541 |
| Molecular Formula | C26H22ClN3O3 |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 3-[[4-chloro-1-(4-methylphenyl)-2,5-dioxopyrrol-3-yl]amino]-4-methyl-N-(2-methylphenyl)benzamide |
| SMILES | Cc1ccc(N2C(=O)C(Cl)=C(Nc3cc(C(=O)Nc4ccccc4C)ccc3C)C2=O)cc1 |
| InChI | InChI=1S/C26H22ClN3O3/c1-15-8-12-19(13-9-15)30-25(32)22(27)23(26(30)33)28-21-14-18(11-10-17(21)3)24(31)29-20-7-5-4-6-16(20)2/h4-14,28H,1-3H3,(H,29,31) |
| InChIKey | HMKZOGQHFCLNQR-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|