C24H15Cl2F2N3O3 — CID 1407792
3-[[4-chloro-1-(3-chloro-4-fluorophenyl)-2,5-dioxopyrrol-3-yl]amino]-N-(2-fluorophenyl)-4-methylbenzamide (PubChem CID 1407792) has the molecular formula C24H15Cl2F2N3O3 and a molecular weight of 502.30 g/mol. Its IUPAC name is 3-[[4-chloro-1-(3-chloro-4-fluorophenyl)-2,5-dioxopyrrol-3-yl]amino]-N-(2-fluorophenyl)-4-methylbenzamide.
| Compound Name | 3-[[4-chloro-1-(3-chloro-4-fluorophenyl)-2,5-dioxopyrrol-3-yl]amino]-N-(2-fluorophenyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 1407792 |
| Molecular Formula | C24H15Cl2F2N3O3 |
| Molecular Weight | 502.30 g/mol |
| Exact Mass | 501.05 |
| IUPAC Name | 3-[[4-chloro-1-(3-chloro-4-fluorophenyl)-2,5-dioxopyrrol-3-yl]amino]-N-(2-fluorophenyl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccccc2F)cc1NC1=C(Cl)C(=O)N(c2ccc(F)c(Cl)c2)C1=O |
| InChI | InChI=1S/C24H15Cl2F2N3O3/c1-12-6-7-13(22(32)30-18-5-3-2-4-17(18)28)10-19(12)29-21-20(26)23(33)31(24(21)34)14-8-9-16(27)15(25)11-14/h2-11,29H,1H3,(H,30,32) |
| InChIKey | MVCDXGUABCEGPX-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.30 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|