C22H19Cl2N3O4 — CID 1407609
3-chloro-1-(4-chlorophenyl)-4-[2-methyl-5-(morpholine-4-carbonyl)anilino]pyrrole-2,5-dione (PubChem CID 1407609) has the molecular formula C22H19Cl2N3O4 and a molecular weight of 460.32 g/mol. Its IUPAC name is 3-chloro-1-(4-chlorophenyl)-4-[2-methyl-5-(morpholine-4-carbonyl)anilino]pyrrole-2,5-dione.
| Compound Name | 3-chloro-1-(4-chlorophenyl)-4-[2-methyl-5-(morpholine-4-carbonyl)anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 1407609 |
| Molecular Formula | C22H19Cl2N3O4 |
| Molecular Weight | 460.32 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | 3-chloro-1-(4-chlorophenyl)-4-[2-methyl-5-(morpholine-4-carbonyl)anilino]pyrrole-2,5-dione |
| SMILES | Cc1ccc(C(=O)N2CCOCC2)cc1NC1=C(Cl)C(=O)N(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C22H19Cl2N3O4/c1-13-2-3-14(20(28)26-8-10-31-11-9-26)12-17(13)25-19-18(24)21(29)27(22(19)30)16-6-4-15(23)5-7-16/h2-7,12,25H,8-11H2,1H3 |
| InChIKey | DQNHYRHXHVCDDF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|