C27H21Cl2N3O3 — CID 1407606
3-chloro-1-(4-chlorophenyl)-4-[5-(3,4-dihydro-2H-quinoline-1-carbonyl)-2-methylanilino]pyrrole-2,5-dione (PubChem CID 1407606) has the molecular formula C27H21Cl2N3O3 and a molecular weight of 506.39 g/mol. Its IUPAC name is 3-chloro-1-(4-chlorophenyl)-4-[5-(3,4-dihydro-2H-quinoline-1-carbonyl)-2-methylanilino]pyrrole-2,5-dione.
| Compound Name | 3-chloro-1-(4-chlorophenyl)-4-[5-(3,4-dihydro-2H-quinoline-1-carbonyl)-2-methylanilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 1407606 |
| Molecular Formula | C27H21Cl2N3O3 |
| Molecular Weight | 506.39 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | 3-chloro-1-(4-chlorophenyl)-4-[5-(3,4-dihydro-2H-quinoline-1-carbonyl)-2-methylanilino]pyrrole-2,5-dione |
| SMILES | Cc1ccc(C(=O)N2CCCc3ccccc32)cc1NC1=C(Cl)C(=O)N(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C27H21Cl2N3O3/c1-16-8-9-18(25(33)31-14-4-6-17-5-2-3-7-22(17)31)15-21(16)30-24-23(29)26(34)32(27(24)35)20-12-10-19(28)11-13-20/h2-3,5,7-13,15,30H,4,6,14H2,1H3 |
| InChIKey | VFIKJEBAKVDKHA-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.39 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|