C29H27ClN4O4 — CID 1407871
3-chloro-1-(4-methoxyphenyl)-4-[2-methyl-5-(4-phenylpiperazine-1-carbonyl)anilino]pyrrole-2,5-dione (PubChem CID 1407871) has the molecular formula C29H27ClN4O4 and a molecular weight of 531.01 g/mol. Its IUPAC name is 3-chloro-1-(4-methoxyphenyl)-4-[2-methyl-5-(4-phenylpiperazine-1-carbonyl)anilino]pyrrole-2,5-dione.
| Compound Name | 3-chloro-1-(4-methoxyphenyl)-4-[2-methyl-5-(4-phenylpiperazine-1-carbonyl)anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 1407871 |
| Molecular Formula | C29H27ClN4O4 |
| Molecular Weight | 531.01 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | 3-chloro-1-(4-methoxyphenyl)-4-[2-methyl-5-(4-phenylpiperazine-1-carbonyl)anilino]pyrrole-2,5-dione |
| SMILES | COc1ccc(N2C(=O)C(Cl)=C(Nc3cc(C(=O)N4CCN(c5ccccc5)CC4)ccc3C)C2=O)cc1 |
| InChI | InChI=1S/C29H27ClN4O4/c1-19-8-9-20(27(35)33-16-14-32(15-17-33)21-6-4-3-5-7-21)18-24(19)31-26-25(30)28(36)34(29(26)37)22-10-12-23(38-2)13-11-22/h3-13,18,31H,14-17H2,1-2H3 |
| InChIKey | JKEKACGDVCETLS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.01 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|